C18H24 — CID 159034840
2-but-3-enyl-1,3-bis(cyclopropylmethyl)benzene (PubChem CID 159034840) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-but-3-enyl-1,3-bis(cyclopropylmethyl)benzene.
| Compound Name | 2-but-3-enyl-1,3-bis(cyclopropylmethyl)benzene |
|---|---|
| PubChem CID | 159034840 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-but-3-enyl-1,3-bis(cyclopropylmethyl)benzene |
| SMILES | C=CCCc1c(CC2CC2)cccc1CC1CC1 |
| InChI | InChI=1S/C18H24/c1-2-3-7-18-16(12-14-8-9-14)5-4-6-17(18)13-15-10-11-15/h2,4-6,14-15H,1,3,7-13H2 |
| InChIKey | RZJOSFYLNXEBEA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|