C36H28O4S — CID 159040266
5-[4-(2-naphthalen-1-ylethyl)phenyl]-2-(naphthalen-2-ylsulfonylmethyl)benzoic acid (PubChem CID 159040266) has the molecular formula C36H28O4S and a molecular weight of 556.68 g/mol. Its IUPAC name is 5-[4-(2-naphthalen-1-ylethyl)phenyl]-2-(naphthalen-2-ylsulfonylmethyl)benzoic acid.
| Compound Name | 5-[4-(2-naphthalen-1-ylethyl)phenyl]-2-(naphthalen-2-ylsulfonylmethyl)benzoic acid |
|---|---|
| PubChem CID | 159040266 |
| Molecular Formula | C36H28O4S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 5-[4-(2-naphthalen-1-ylethyl)phenyl]-2-(naphthalen-2-ylsulfonylmethyl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(CCc3cccc4ccccc34)cc2)ccc1CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H28O4S/c37-36(38)35-23-31(18-19-32(35)24-41(39,40)33-21-20-26-6-1-2-8-30(26)22-33)27-15-12-25(13-16-27)14-17-29-10-5-9-28-7-3-4-11-34(28)29/h1-13,15-16,18-23H,14,17,24H2,(H,37,38) |
| InChIKey | OKPVTXPDZCZJMD-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |