C24H20N4O — CID 159040870
6,7-dimethyl-N-(7-phenoxy-1H-indol-4-yl)quinazolin-4-amine (PubChem CID 159040870) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is 6,7-dimethyl-N-(7-phenoxy-1H-indol-4-yl)quinazolin-4-amine.
| Compound Name | 6,7-dimethyl-N-(7-phenoxy-1H-indol-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 159040870 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6,7-dimethyl-N-(7-phenoxy-1H-indol-4-yl)quinazolin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccc(Oc4ccccc4)c4[nH]ccc34)c2cc1C |
| InChI | InChI=1S/C24H20N4O/c1-15-12-19-21(13-16(15)2)26-14-27-24(19)28-20-8-9-22(23-18(20)10-11-25-23)29-17-6-4-3-5-7-17/h3-14,25H,1-2H3,(H,26,27,28) |
| InChIKey | UFKUUVLSFHFUMK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |