C15H18N2O2S2 — CID 159044963
1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]nonane-1,7-dione (PubChem CID 159044963) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]nonane-1,7-dione.
| Compound Name | 1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]nonane-1,7-dione |
|---|---|
| PubChem CID | 159044963 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-[2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]nonane-1,7-dione |
| SMILES | CCC(=O)CCCCCC(=O)c1csc(-c2nccs2)n1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-2-11(18)6-4-3-5-7-13(19)12-10-21-15(17-12)14-16-8-9-20-14/h8-10H,2-7H2,1H3 |
| InChIKey | GPLPCJQLGBWQMP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|