C23H19F6S+ — CID 159046435
1,1,2,3,3,4-hexafluorobut-1-ene;(4-methylphenyl)-diphenylsulfanium (PubChem CID 159046435) has the molecular formula C23H19F6S+ and a molecular weight of 441.46 g/mol. Its IUPAC name is 1,1,2,3,3,4-hexafluorobut-1-ene;(4-methylphenyl)-diphenylsulfanium.
| Compound Name | 1,1,2,3,3,4-hexafluorobut-1-ene;(4-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 159046435 |
| Molecular Formula | C23H19F6S+ |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 1,1,2,3,3,4-hexafluorobut-1-ene;(4-methylphenyl)-diphenylsulfanium |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.FCC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C19H17S.C4H2F6/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;5-1-4(9,10)2(6)3(7)8/h2-15H,1H3;1H2/q+1; |
| InChIKey | JWSFOYPCDQPQRF-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|