C27H46N2O7 — CID 159056499
[(3R,4S,6R)-6-[6-[(2R,4R)-2-(deuteriomethyl)-4-[1-(2-isocyanoethoxy)ethoxy]pyrrolidin-1-yl]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate (PubChem CID 159056499) has the molecular formula C27H46N2O7 and a molecular weight of 511.68 g/mol. Its IUPAC name is [(3R,4S,6R)-6-[6-[(2R,4R)-2-(deuteriomethyl)-4-[1-(2-isocyanoethoxy)ethoxy]pyrrolidin-1-yl]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-6-[6-[(2R,4R)-2-(deuteriomethyl)-4-[1-(2-isocyanoethoxy)ethoxy]pyrrolidin-1-yl]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 159056499 |
| Molecular Formula | C27H46N2O7 |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | [(3R,4S,6R)-6-[6-[(2R,4R)-2-(deuteriomethyl)-4-[1-(2-isocyanoethoxy)ethoxy]pyrrolidin-1-yl]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate |
| SMILES | [2H]C[C@@H]1C[C@@H](OC(C)OCC[N+]#[C-])CN1C(=O)CCCCCO[C@@H]1OC(COC(C)=O)[C@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C27H46N2O7/c1-18-15-24(35-23(6)32-14-12-28-7)16-29(18)26(31)11-9-8-10-13-33-27-21(4)19(2)20(3)25(36-27)17-34-22(5)30/h18-21,23-25,27H,8-17H2,1-6H3/t18-,19+,20-,21?,23?,24-,25?,27-/m1/s1/i1D |
| InChIKey | OHJIVEBEQDFFAN-PKLBAYMLSA-N |
| XLogP | 4.05 |
| TPSA | 87.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|