C24H31N3O3 — CID 159058886
benzyl 7-[4-(3-hydroxypropyl)piperazin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 159058886) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is benzyl 7-[4-(3-hydroxypropyl)piperazin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 7-[4-(3-hydroxypropyl)piperazin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 159058886 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | benzyl 7-[4-(3-hydroxypropyl)piperazin-1-yl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2ccc(N3CCN(CCCO)CC3)cc2C1 |
| InChI | InChI=1S/C24H31N3O3/c28-16-4-10-25-12-14-26(15-13-25)23-8-7-21-9-11-27(18-22(21)17-23)24(29)30-19-20-5-2-1-3-6-20/h1-3,5-8,17,28H,4,9-16,18-19H2 |
| InChIKey | OHYPLZLMQHCCCE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|