C32H37Br2ClN6O6 — CID 159078524
4-amino-1-methylcyclohexan-1-ol;6-bromo-4-chloro-3-nitroquinoline;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol (PubChem CID 159078524) has the molecular formula C32H37Br2ClN6O6 and a molecular weight of 796.94 g/mol. Its IUPAC name is 4-amino-1-methylcyclohexan-1-ol;6-bromo-4-chloro-3-nitroquinoline;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-amino-1-methylcyclohexan-1-ol;6-bromo-4-chloro-3-nitroquinoline;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 159078524 |
| Molecular Formula | C32H37Br2ClN6O6 |
| Molecular Weight | 796.94 g/mol |
| Exact Mass | 794.08 |
| IUPAC Name | 4-amino-1-methylcyclohexan-1-ol;6-bromo-4-chloro-3-nitroquinoline;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(N)CC1.CC1(O)CCC(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)CC1.O=[N+]([O-])c1cnc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C16H18BrN3O3.C9H4BrClN2O2.C7H15NO/c1-16(21)6-4-11(5-7-16)19-15-12-8-10(17)2-3-13(12)18-9-14(15)20(22)23;10-5-1-2-7-6(3-5)9(11)8(4-12-7)13(14)15;1-7(9)4-2-6(8)3-5-7/h2-3,8-9,11,21H,4-7H2,1H3,(H,18,19);1-4H;6,9H,2-5,8H2,1H3 |
| InChIKey | KAODICSIIANSHD-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 190.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.94 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|