C15H18F4N2O — CID 159081913
1-[4-fluoro-4-[2-(trifluoromethyl)-4-pyridinyl]piperidin-1-yl]butan-1-one (PubChem CID 159081913) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-[4-fluoro-4-[2-(trifluoromethyl)-4-pyridinyl]piperidin-1-yl]butan-1-one.
| Compound Name | 1-[4-fluoro-4-[2-(trifluoromethyl)-4-pyridinyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 159081913 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-[4-fluoro-4-[2-(trifluoromethyl)-4-pyridinyl]piperidin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCC(F)(c2ccnc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18F4N2O/c1-2-3-13(22)21-8-5-14(16,6-9-21)11-4-7-20-12(10-11)15(17,18)19/h4,7,10H,2-3,5-6,8-9H2,1H3 |
| InChIKey | KAYRMAZGSULUDH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |