C19H20O4S2 — CID 159095703
4-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]butan-2-one (PubChem CID 159095703) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]butan-2-one.
| Compound Name | 4-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 159095703 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 4-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(Oc2ccc(S(=O)(=O)CC3CS3)cc2)cc1 |
| InChI | InChI=1S/C19H20O4S2/c1-14(20)2-3-15-4-6-16(7-5-15)23-17-8-10-19(11-9-17)25(21,22)13-18-12-24-18/h4-11,18H,2-3,12-13H2,1H3 |
| InChIKey | KCQHATAVDTUCGX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|