C15H14ClNO3S2 — CID 89418675
N-chloro-4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]aniline (PubChem CID 89418675) has the molecular formula C15H14ClNO3S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is N-chloro-4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]aniline.
| Compound Name | N-chloro-4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]aniline |
|---|---|
| PubChem CID | 89418675 |
| Molecular Formula | C15H14ClNO3S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-chloro-4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]aniline |
| SMILES | O=S(=O)(CC1CS1)c1ccc(Oc2ccc(NCl)cc2)cc1 |
| InChI | InChI=1S/C15H14ClNO3S2/c16-17-11-1-3-12(4-2-11)20-13-5-7-15(8-6-13)22(18,19)10-14-9-21-14/h1-8,14,17H,9-10H2 |
| InChIKey | QVJCZZHDUSDBLI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|