C16H16O3S3 — CID 53350124
2-[[4-(4-methylsulfanylphenoxy)phenyl]sulfonylmethyl]thiirane (PubChem CID 53350124) has the molecular formula C16H16O3S3 and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[[4-(4-methylsulfanylphenoxy)phenyl]sulfonylmethyl]thiirane.
| Compound Name | 2-[[4-(4-methylsulfanylphenoxy)phenyl]sulfonylmethyl]thiirane |
|---|---|
| PubChem CID | 53350124 |
| Molecular Formula | C16H16O3S3 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[[4-(4-methylsulfanylphenoxy)phenyl]sulfonylmethyl]thiirane |
| SMILES | CSc1ccc(Oc2ccc(S(=O)(=O)CC3CS3)cc2)cc1 |
| InChI | InChI=1S/C16H16O3S3/c1-20-14-6-2-12(3-7-14)19-13-4-8-16(9-5-13)22(17,18)11-15-10-21-15/h2-9,15H,10-11H2,1H3 |
| InChIKey | GQVKATBKLCQOSJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|