C20H23ClN2O6S2 — CID 54757405
(4S)-4-amino-5-oxo-5-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]anilino]pentanoic acid;hydrochloride (PubChem CID 54757405) has the molecular formula C20H23ClN2O6S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is (4S)-4-amino-5-oxo-5-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]anilino]pentanoic acid;hydrochloride.
| Compound Name | (4S)-4-amino-5-oxo-5-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]anilino]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 54757405 |
| Molecular Formula | C20H23ClN2O6S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (4S)-4-amino-5-oxo-5-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]anilino]pentanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CCC(=O)O)C(=O)Nc1ccc(Oc2ccc(S(=O)(=O)CC3CS3)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O6S2.ClH/c21-18(9-10-19(23)24)20(25)22-13-1-3-14(4-2-13)28-15-5-7-17(8-6-15)30(26,27)12-16-11-29-16;/h1-8,16,18H,9-12,21H2,(H,22,25)(H,23,24);1H/t16?,18-;/m0./s1 |
| InChIKey | TURINNDHCNSETJ-IXKLIVBYSA-N |
| XLogP | 2.92 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|