C15H14O4S2 — CID 15941550
4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenol (PubChem CID 15941550) has the molecular formula C15H14O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenol.
| Compound Name | 4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenol |
|---|---|
| PubChem CID | 15941550 |
| Molecular Formula | C15H14O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenol |
| SMILES | O=S(=O)(CC1CS1)c1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H14O4S2/c16-11-1-3-12(4-2-11)19-13-5-7-15(8-6-13)21(17,18)10-14-9-20-14/h1-8,14,16H,9-10H2 |
| InChIKey | AHDPJKYOQXMDIX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|