C24H17F3N3- — CID 159098890
[3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]phenyl]azanide (PubChem CID 159098890) has the molecular formula C24H17F3N3- and a molecular weight of 404.42 g/mol. Its IUPAC name is [3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]phenyl]azanide.
| Compound Name | [3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]phenyl]azanide |
|---|---|
| PubChem CID | 159098890 |
| Molecular Formula | C24H17F3N3- |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [3-[6-[6-methyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]-2-pyridinyl]phenyl]azanide |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(-c3cccc([NH-])c3)n2)n1 |
| InChI | InChI=1S/C24H17F3N3/c1-15-12-18(16-8-10-19(11-9-16)24(25,26)27)14-23(29-15)22-7-3-6-21(30-22)17-4-2-5-20(28)13-17/h2-14,28H,1H3/q-1 |
| InChIKey | KDAGKZBEPSOMGU-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |