About (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine
(6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine (PubChem CID 159111888) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine.
Molecular Properties
| Compound Name | (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine |
| PubChem CID | 159111888 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine |
| SMILES | CCCC1CCC2(NC)C(C)C12 |
| InChI | InChI=1S/C11H21N/c1-4-5-9-6-7-11(12-3)8(2)10(9)11/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | KEPJDSMKEHPSSV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine?
The IUPAC name of (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine (CID 159111888) is (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine.
What is the SMILES notation for (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine?
The canonical SMILES for (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine is CCCC1CCC2(NC)C(C)C12.
What is the InChIKey of (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine?
The InChIKey is KEPJDSMKEHPSSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-4-5-9-6-7-11(12-3)8(2)10(9)11/h8-10,12H,4-7H2,1-3H3.
What are the key properties of (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine?
(6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine has a molecular weight of 167.30 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-N,6-dimethyl-4-propylbicyclo[3.1.0]hexan-1-amine is sourced from PubChem (CID 159111888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).