C23H22F10O4 — CID 159137055
[4,5,5,6,6-pentafluoro-4-[2-[1,5,5,6,6-pentafluoro-4-(2-methylprop-2-enoyloxy)cyclohex-2-en-1-yl]propan-2-yl]cyclohex-2-en-1-yl] 2-methylprop-2-enoate (PubChem CID 159137055) has the molecular formula C23H22F10O4 and a molecular weight of 552.41 g/mol. Its IUPAC name is [4,5,5,6,6-pentafluoro-4-[2-[1,5,5,6,6-pentafluoro-4-(2-methylprop-2-enoyloxy)cyclohex-2-en-1-yl]propan-2-yl]cyclohex-2-en-1-yl] 2-methylprop-2-enoate.
| Compound Name | [4,5,5,6,6-pentafluoro-4-[2-[1,5,5,6,6-pentafluoro-4-(2-methylprop-2-enoyloxy)cyclohex-2-en-1-yl]propan-2-yl]cyclohex-2-en-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159137055 |
| Molecular Formula | C23H22F10O4 |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [4,5,5,6,6-pentafluoro-4-[2-[1,5,5,6,6-pentafluoro-4-(2-methylprop-2-enoyloxy)cyclohex-2-en-1-yl]propan-2-yl]cyclohex-2-en-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C=CC(F)(C(C)(C)C2(F)C=CC(OC(=O)C(=C)C)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H22F10O4/c1-11(2)15(34)36-13-7-9-18(24,22(30,31)20(13,26)27)17(5,6)19(25)10-8-14(37-16(35)12(3)4)21(28,29)23(19,32)33/h7-10,13-14H,1,3H2,2,4-6H3 |
| InChIKey | KHPXHQPHVKCQTK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|