C8H5F8NO2 — CID 145067991
(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl) 2-methylprop-2-enoate (PubChem CID 145067991) has the molecular formula C8H5F8NO2 and a molecular weight of 299.12 g/mol. Its IUPAC name is (2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl) 2-methylprop-2-enoate.
| Compound Name | (2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145067991 |
| Molecular Formula | C8H5F8NO2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ON1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H5F8NO2/c1-3(2)4(18)19-17-7(13,14)5(9,10)6(11,12)8(17,15)16/h1H2,2H3 |
| InChIKey | AKJRUNSSMXWGJR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|