C28H36O10 — CID 159139474
ethyl 4-methyl-3-oxopentanoate;7-hydroxy-6-methoxy-4-propan-2-ylchromen-2-one;4-methoxybenzene-1,3-diol (PubChem CID 159139474) has the molecular formula C28H36O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is ethyl 4-methyl-3-oxopentanoate;7-hydroxy-6-methoxy-4-propan-2-ylchromen-2-one;4-methoxybenzene-1,3-diol.
| Compound Name | ethyl 4-methyl-3-oxopentanoate;7-hydroxy-6-methoxy-4-propan-2-ylchromen-2-one;4-methoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 159139474 |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | ethyl 4-methyl-3-oxopentanoate;7-hydroxy-6-methoxy-4-propan-2-ylchromen-2-one;4-methoxybenzene-1,3-diol |
| SMILES | CCOC(=O)CC(=O)C(C)C.COc1cc2c(C(C)C)cc(=O)oc2cc1O.COc1ccc(O)cc1O |
| InChI | InChI=1S/C13H14O4.C8H14O3.C7H8O3/c1-7(2)8-5-13(15)17-11-6-10(14)12(16-3)4-9(8)11;1-4-11-8(10)5-7(9)6(2)3;1-10-7-3-2-5(8)4-6(7)9/h4-7,14H,1-3H3;6H,4-5H2,1-3H3;2-4,8-9H,1H3 |
| InChIKey | KHXLGNYQZRSUDV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|