C13H16Cl2N2S2 — CID 159144834
methane;methyl N-[2-(4,6-dichloro-1H-indol-3-yl)ethyl]carbamodithioate (PubChem CID 159144834) has the molecular formula C13H16Cl2N2S2 and a molecular weight of 335.33 g/mol. Its IUPAC name is methane;methyl N-[2-(4,6-dichloro-1H-indol-3-yl)ethyl]carbamodithioate.
| Compound Name | methane;methyl N-[2-(4,6-dichloro-1H-indol-3-yl)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 159144834 |
| Molecular Formula | C13H16Cl2N2S2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | methane;methyl N-[2-(4,6-dichloro-1H-indol-3-yl)ethyl]carbamodithioate |
| SMILES | C.CSC(=S)NCCc1c[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C12H12Cl2N2S2.CH4/c1-18-12(17)15-3-2-7-6-16-10-5-8(13)4-9(14)11(7)10;/h4-6,16H,2-3H2,1H3,(H,15,17);1H4 |
| InChIKey | KINYGLSAOBNGOT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|