C32H35NO3 — CID 159146242
1-isoquinolin-6-yl-3-methyl-3-phenylpentan-2-one;2-methyl-2-phenylbutanoic acid (PubChem CID 159146242) has the molecular formula C32H35NO3 and a molecular weight of 481.64 g/mol. Its IUPAC name is 1-isoquinolin-6-yl-3-methyl-3-phenylpentan-2-one;2-methyl-2-phenylbutanoic acid.
| Compound Name | 1-isoquinolin-6-yl-3-methyl-3-phenylpentan-2-one;2-methyl-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 159146242 |
| Molecular Formula | C32H35NO3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 1-isoquinolin-6-yl-3-methyl-3-phenylpentan-2-one;2-methyl-2-phenylbutanoic acid |
| SMILES | CCC(C)(C(=O)Cc1ccc2cnccc2c1)c1ccccc1.CCC(C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO.C11H14O2/c1-3-21(2,19-7-5-4-6-8-19)20(23)14-16-9-10-18-15-22-12-11-17(18)13-16;1-3-11(2,10(12)13)9-7-5-4-6-8-9/h4-13,15H,3,14H2,1-2H3;4-8H,3H2,1-2H3,(H,12,13) |
| InChIKey | KISHJXOEAROQEN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |