C20H32N2O2S3 — CID 159156031
butan-2-ylbenzene;2,2-dimethylbutanoic acid;5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 159156031) has the molecular formula C20H32N2O2S3 and a molecular weight of 428.69 g/mol. Its IUPAC name is butan-2-ylbenzene;2,2-dimethylbutanoic acid;5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | butan-2-ylbenzene;2,2-dimethylbutanoic acid;5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 159156031 |
| Molecular Formula | C20H32N2O2S3 |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | butan-2-ylbenzene;2,2-dimethylbutanoic acid;5-ethylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCC(C)(C)C(=O)O.CCC(C)c1ccccc1.CCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C10H14.C6H12O2.C4H6N2S3/c1-3-9(2)10-7-5-4-6-8-10;1-4-6(2,3)5(7)8;1-2-8-4-6-5-3(7)9-4/h4-9H,3H2,1-2H3;4H2,1-3H3,(H,7,8);2H2,1H3,(H,5,7) |
| InChIKey | KJXBRGALORXJNC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|