C41H38N6O7 — CID 159157464
(2,5-dioxopyrrolidin-1-yl) 3-[(1-ethyl-3H-indol-2-ylidene)carbamoyl]benzoate;3-N-(1-ethyl-3H-indol-2-ylidene)-1-N-methylbenzene-1,3-dicarboxamide (PubChem CID 159157464) has the molecular formula C41H38N6O7 and a molecular weight of 726.79 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[(1-ethyl-3H-indol-2-ylidene)carbamoyl]benzoate;3-N-(1-ethyl-3H-indol-2-ylidene)-1-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[(1-ethyl-3H-indol-2-ylidene)carbamoyl]benzoate;3-N-(1-ethyl-3H-indol-2-ylidene)-1-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 159157464 |
| Molecular Formula | C41H38N6O7 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[(1-ethyl-3H-indol-2-ylidene)carbamoyl]benzoate;3-N-(1-ethyl-3H-indol-2-ylidene)-1-N-methylbenzene-1,3-dicarboxamide |
| SMILES | CCN1/C(=N/C(=O)c2cccc(C(=O)NC)c2)Cc2ccccc21.CCN1/C(=N/C(=O)c2cccc(C(=O)ON3C(=O)CCC3=O)c2)Cc2ccccc21 |
| InChI | InChI=1S/C22H19N3O5.C19H19N3O2/c1-2-24-17-9-4-3-6-14(17)13-18(24)23-21(28)15-7-5-8-16(12-15)22(29)30-25-19(26)10-11-20(25)27;1-3-22-16-10-5-4-7-13(16)12-17(22)21-19(24)15-9-6-8-14(11-15)18(23)20-2/h3-9,12H,2,10-11,13H2,1H3;4-11H,3,12H2,1-2H3,(H,20,23)/b23-18+;21-17+ |
| InChIKey | KKBMOVWLLWVTHN-FFTGRXBKSA-N |
| XLogP | 5.20 |
| TPSA | 158.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|