C24H31N2+ — CID 159165051
6-(2,4-dimethylpentan-3-yl)-2,3-dimethyl-1-(4-methyl-3-pyridinyl)isoquinolin-2-ium (PubChem CID 159165051) has the molecular formula C24H31N2+ and a molecular weight of 347.53 g/mol. Its IUPAC name is 6-(2,4-dimethylpentan-3-yl)-2,3-dimethyl-1-(4-methyl-3-pyridinyl)isoquinolin-2-ium.
| Compound Name | 6-(2,4-dimethylpentan-3-yl)-2,3-dimethyl-1-(4-methyl-3-pyridinyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 159165051 |
| Molecular Formula | C24H31N2+ |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | 6-(2,4-dimethylpentan-3-yl)-2,3-dimethyl-1-(4-methyl-3-pyridinyl)isoquinolin-2-ium |
| SMILES | Cc1ccncc1-c1c2ccc(C(C(C)C)C(C)C)cc2cc(C)[n+]1C |
| InChI | InChI=1S/C24H31N2/c1-15(2)23(16(3)4)19-8-9-21-20(13-19)12-18(6)26(7)24(21)22-14-25-11-10-17(22)5/h8-16,23H,1-7H3/q+1 |
| InChIKey | VBKMUYUDAPVNPP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|