C27H50O7 — CID 159165729
2,3-dihydroxypropyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate;2-hydroxyethyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 159165729) has the molecular formula C27H50O7 and a molecular weight of 486.69 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate;2-hydroxyethyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | 2,3-dihydroxypropyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate;2-hydroxyethyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 159165729 |
| Molecular Formula | C27H50O7 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | 2,3-dihydroxypropyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate;2-hydroxyethyl (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)OCC(O)CO.CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)OCCO |
| InChI | InChI=1S/C14H26O4.C13H24O3/c1-9(2)12-5-4-10(3)6-13(12)14(17)18-8-11(16)7-15;1-9(2)11-5-4-10(3)8-12(11)13(15)16-7-6-14/h9-13,15-16H,4-8H2,1-3H3;9-12,14H,4-8H2,1-3H3/t10-,11?,12+,13-;10-,11+,12-/m11/s1 |
| InChIKey | KLAVQULKOKJIKW-OCSWJTSFSA-N |
| XLogP | 3.82 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |