C18H22N2O3 — CID 159167604
(E)-4-[2-(2-acetyl-2,5-diazaspiro[3.4]octan-5-yl)phenyl]-1-hydroxybut-3-en-2-one (PubChem CID 159167604) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (E)-4-[2-(2-acetyl-2,5-diazaspiro[3.4]octan-5-yl)phenyl]-1-hydroxybut-3-en-2-one.
| Compound Name | (E)-4-[2-(2-acetyl-2,5-diazaspiro[3.4]octan-5-yl)phenyl]-1-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 159167604 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (E)-4-[2-(2-acetyl-2,5-diazaspiro[3.4]octan-5-yl)phenyl]-1-hydroxybut-3-en-2-one |
| SMILES | CC(=O)N1CC2(CCCN2c2ccccc2/C=C/C(=O)CO)C1 |
| InChI | InChI=1S/C18H22N2O3/c1-14(22)19-12-18(13-19)9-4-10-20(18)17-6-3-2-5-15(17)7-8-16(23)11-21/h2-3,5-8,21H,4,9-13H2,1H3/b8-7+ |
| InChIKey | KLGTXFBBRVOIPL-BQYQJAHWSA-N |
| XLogP | 1.46 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|