C26H33ClN2O7 — CID 159192303
7-chloro-N-[(4-cyclopentyloxyphenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 159192303) has the molecular formula C26H33ClN2O7 and a molecular weight of 521.01 g/mol. Its IUPAC name is 7-chloro-N-[(4-cyclopentyloxyphenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | 7-chloro-N-[(4-cyclopentyloxyphenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 159192303 |
| Molecular Formula | C26H33ClN2O7 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 7-chloro-N-[(4-cyclopentyloxyphenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | Clc1ccc2c(c1NCc1ccc(OC3CCCC3)cc1)CCNCC2.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C22H27ClN2O.C4H6O6/c23-21-10-7-17-11-13-24-14-12-20(17)22(21)25-15-16-5-8-19(9-6-16)26-18-3-1-2-4-18;5-1(3(7)8)2(6)4(9)10/h5-10,18,24-25H,1-4,11-15H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | MXAALMWMPFBAFP-LREBCSMRSA-N |
| XLogP | 2.84 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |