C30H41ClN2O7 — CID 160968122
1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-6,6-dimethylheptan-3-one;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 160968122) has the molecular formula C30H41ClN2O7 and a molecular weight of 577.12 g/mol. Its IUPAC name is 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-6,6-dimethylheptan-3-one;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-6,6-dimethylheptan-3-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 160968122 |
| Molecular Formula | C30H41ClN2O7 |
| Molecular Weight | 577.12 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 1-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-6,6-dimethylheptan-3-one;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | CC(C)(C)CCC(=O)CCc1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C26H35ClN2O.C4H6O6/c1-26(2,3)15-12-22(30)10-8-19-4-6-20(7-5-19)18-29-25-23-14-17-28-16-13-21(23)9-11-24(25)27;5-1(3(7)8)2(6)4(9)10/h4-7,9,11,28-29H,8,10,12-18H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | VZEPPQXZLCZRCW-LREBCSMRSA-N |
| XLogP | 3.85 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |