About 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid
4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid (PubChem CID 159200744) has the molecular formula C29H41BrN4O6
and a molecular weight of 621.57 g/mol. Its IUPAC name is 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid |
| PubChem CID | 159200744 |
| Molecular Formula | C29H41BrN4O6 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.O=C(O)c1ccc(CBr)cc1.O=C(O)c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C12H16N2O2.C9H18N2O2.C8H7BrO2/c15-12(16)11-3-1-10(2-4-11)9-14-7-5-13-6-8-14;1-9(2,3)13-8(12)11-6-4-10-5-7-11;9-5-6-1-3-7(4-2-6)8(10)11/h1-4,13H,5-9H2,(H,15,16);10H,4-7H2,1-3H3;1-4H,5H2,(H,10,11) |
| InChIKey | KPGGFCOXKWGHOM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid?
The IUPAC name of 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid (CID 159200744) is 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid.
What is the SMILES notation for 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid?
The canonical SMILES for 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid is CC(C)(C)OC(=O)N1CCNCC1.O=C(O)c1ccc(CBr)cc1.O=C(O)c1ccc(CN2CCNCC2)cc1.
What is the InChIKey of 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid?
The InChIKey is KPGGFCOXKWGHOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2.C9H18N2O2.C8H7BrO2/c15-12(16)11-3-1-10(2-4-11)9-14-7-5-13-6-8-14;1-9(2,3)13-8(12)11-6-4-10-5-7-11;9-5-6-1-3-7(4-2-6)8(10)11/h1-4,13H,5-9H2,(H,15,16);10H,4-7H2,1-3H3;1-4H,5H2,(H,10,11).
What are the key properties of 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid?
4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid has a molecular weight of 621.57 g/mol, XLogP of 3.90, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)benzoic acid;tert-butyl piperazine-1-carboxylate;4-(piperazin-1-ylmethyl)benzoic acid is sourced from PubChem (CID 159200744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).