C13H15N — CID 15920833
5-(7-methylidene-1-bicyclo[4.2.0]octa-2,4-dienyl)-3,4-dihydro-2H-pyrrole (PubChem CID 15920833) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-(7-methylidene-1-bicyclo[4.2.0]octa-2,4-dienyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(7-methylidene-1-bicyclo[4.2.0]octa-2,4-dienyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 15920833 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-(7-methylidene-1-bicyclo[4.2.0]octa-2,4-dienyl)-3,4-dihydro-2H-pyrrole |
| SMILES | C=C1CC2(C3=NCCC3)C=CC=CC12 |
| InChI | InChI=1S/C13H15N/c1-10-9-13(12-6-4-8-14-12)7-3-2-5-11(10)13/h2-3,5,7,11H,1,4,6,8-9H2 |
| InChIKey | HRHDRXQHZNFWBL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|