C25H34F6N4O13 — CID 159209339
4-[[(5S,6R,7S,8R)-9-[[4,7-dioxo-5-[(2,2,2-trifluoroacetyl)amino]octyl]amino]-5,6,7,8-tetrahydroxy-4,9-dioxononyl]amino]-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 159209339) has the molecular formula C25H34F6N4O13 and a molecular weight of 712.55 g/mol. Its IUPAC name is 4-[[(5S,6R,7S,8R)-9-[[4,7-dioxo-5-[(2,2,2-trifluoroacetyl)amino]octyl]amino]-5,6,7,8-tetrahydroxy-4,9-dioxononyl]amino]-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | 4-[[(5S,6R,7S,8R)-9-[[4,7-dioxo-5-[(2,2,2-trifluoroacetyl)amino]octyl]amino]-5,6,7,8-tetrahydroxy-4,9-dioxononyl]amino]-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 159209339 |
| Molecular Formula | C25H34F6N4O13 |
| Molecular Weight | 712.55 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | 4-[[(5S,6R,7S,8R)-9-[[4,7-dioxo-5-[(2,2,2-trifluoroacetyl)amino]octyl]amino]-5,6,7,8-tetrahydroxy-4,9-dioxononyl]amino]-4-oxo-3-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | CC(=O)CC(NC(=O)C(F)(F)F)C(=O)CCCNC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)CCCNC(=O)C(CC(=O)O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H34F6N4O13/c1-10(36)8-11(34-22(47)24(26,27)28)13(37)4-2-7-33-21(46)19(44)18(43)17(42)16(41)14(38)5-3-6-32-20(45)12(9-15(39)40)35-23(48)25(29,30)31/h11-12,16-19,41-44H,2-9H2,1H3,(H,32,45)(H,33,46)(H,34,47)(H,35,48)(H,39,40)/t11?,12?,16-,17+,18+,19-/m1/s1 |
| InChIKey | KQHFTTHRZQWUHV-ANLJZXBKSA-N |
| XLogP | -3.09 |
| TPSA | 285.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.55 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|