C10H19NS — CID 15922051
2-but-3-en-2-yl-2-propan-2-yl-1,3-thiazolidine (PubChem CID 15922051) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 2-but-3-en-2-yl-2-propan-2-yl-1,3-thiazolidine.
| Compound Name | 2-but-3-en-2-yl-2-propan-2-yl-1,3-thiazolidine |
|---|---|
| PubChem CID | 15922051 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-but-3-en-2-yl-2-propan-2-yl-1,3-thiazolidine |
| SMILES | C=CC(C)C1(C(C)C)NCCS1 |
| InChI | InChI=1S/C10H19NS/c1-5-9(4)10(8(2)3)11-6-7-12-10/h5,8-9,11H,1,6-7H2,2-4H3 |
| InChIKey | ULWPCRREGKZBAI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|