C16H17BrO5 — CID 15922863
[(3aS,9aR,9bR)-9b-bromo-7,7-dimethyl-1,3-dioxo-3a,4,6,9a-tetrahydrobenzo[e][2]benzofuran-9-yl] acetate (PubChem CID 15922863) has the molecular formula C16H17BrO5 and a molecular weight of 369.21 g/mol. Its IUPAC name is [(3aS,9aR,9bR)-9b-bromo-7,7-dimethyl-1,3-dioxo-3a,4,6,9a-tetrahydrobenzo[e][2]benzofuran-9-yl] acetate.
| Compound Name | [(3aS,9aR,9bR)-9b-bromo-7,7-dimethyl-1,3-dioxo-3a,4,6,9a-tetrahydrobenzo[e][2]benzofuran-9-yl] acetate |
|---|---|
| PubChem CID | 15922863 |
| Molecular Formula | C16H17BrO5 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [(3aS,9aR,9bR)-9b-bromo-7,7-dimethyl-1,3-dioxo-3a,4,6,9a-tetrahydrobenzo[e][2]benzofuran-9-yl] acetate |
| SMILES | CC(=O)OC1=CC(C)(C)CC2=CC[C@H]3C(=O)OC(=O)[C@@]3(Br)[C@H]21 |
| InChI | InChI=1S/C16H17BrO5/c1-8(18)21-11-7-15(2,3)6-9-4-5-10-13(19)22-14(20)16(10,17)12(9)11/h4,7,10,12H,5-6H2,1-3H3/t10-,12+,16-/m0/s1 |
| InChIKey | ZPSPWHNKIRNAFV-IETSOEAISA-N |
| XLogP | 2.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|