C16H17BrO6 — CID 101192122
[(1S,3R,5S,9R,10S)-9-bromo-13,13-dimethyl-6,8-dioxo-2,7-dioxatetracyclo[8.4.0.01,3.05,9]tetradec-11-en-11-yl] acetate (PubChem CID 101192122) has the molecular formula C16H17BrO6 and a molecular weight of 385.21 g/mol. Its IUPAC name is [(1S,3R,5S,9R,10S)-9-bromo-13,13-dimethyl-6,8-dioxo-2,7-dioxatetracyclo[8.4.0.01,3.05,9]tetradec-11-en-11-yl] acetate.
| Compound Name | [(1S,3R,5S,9R,10S)-9-bromo-13,13-dimethyl-6,8-dioxo-2,7-dioxatetracyclo[8.4.0.01,3.05,9]tetradec-11-en-11-yl] acetate |
|---|---|
| PubChem CID | 101192122 |
| Molecular Formula | C16H17BrO6 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | [(1S,3R,5S,9R,10S)-9-bromo-13,13-dimethyl-6,8-dioxo-2,7-dioxatetracyclo[8.4.0.01,3.05,9]tetradec-11-en-11-yl] acetate |
| SMILES | CC(=O)OC1=CC(C)(C)C[C@@]23O[C@@H]2C[C@H]2C(=O)OC(=O)[C@@]2(Br)[C@@H]13 |
| InChI | InChI=1S/C16H17BrO6/c1-7(18)21-9-5-14(2,3)6-15-10(23-15)4-8-12(19)22-13(20)16(8,17)11(9)15/h5,8,10-11H,4,6H2,1-3H3/t8-,10+,11-,15+,16-/m0/s1 |
| InChIKey | DDXDCRJYJXNZEI-NGHYIZSVSA-N |
| XLogP | 1.85 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|