C9H8Br2O3 — CID 15530413
(1S,4S,8S)-8-acetyl-4,6-dibromo-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 15530413) has the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. Its IUPAC name is (1S,4S,8S)-8-acetyl-4,6-dibromo-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1S,4S,8S)-8-acetyl-4,6-dibromo-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 15530413 |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | (1S,4S,8S)-8-acetyl-4,6-dibromo-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | CC(=O)[C@@H]1C[C@@H]2OC(=O)[C@@]1(Br)C=C2Br |
| InChI | InChI=1S/C9H8Br2O3/c1-4(12)5-2-7-6(10)3-9(5,11)8(13)14-7/h3,5,7H,2H2,1H3/t5-,7-,9+/m0/s1 |
| InChIKey | NFZBJDRZSCRTEF-XWDQLLGVSA-N |
| XLogP | 1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|