C13H9Br2IO2 — CID 101273738
(1S,4R,8R)-4,6-dibromo-8-(2-iodophenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 101273738) has the molecular formula C13H9Br2IO2 and a molecular weight of 483.93 g/mol. Its IUPAC name is (1S,4R,8R)-4,6-dibromo-8-(2-iodophenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1S,4R,8R)-4,6-dibromo-8-(2-iodophenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 101273738 |
| Molecular Formula | C13H9Br2IO2 |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 481.80 |
| IUPAC Name | (1S,4R,8R)-4,6-dibromo-8-(2-iodophenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | O=C1O[C@H]2C[C@H](c3ccccc3I)[C@@]1(Br)C=C2Br |
| InChI | InChI=1S/C13H9Br2IO2/c14-9-6-13(15)8(5-11(9)18-12(13)17)7-3-1-2-4-10(7)16/h1-4,6,8,11H,5H2/t8-,11+,13+/m1/s1 |
| InChIKey | FAJKEQRRBPSTLR-WLTAIBSBSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|