C11H9BrO2 — CID 54756664
2-(2-bromophenyl)-2,3-dihydropyran-6-one (PubChem CID 54756664) has the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2,3-dihydropyran-6-one.
| Compound Name | 2-(2-bromophenyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 54756664 |
| Molecular Formula | C11H9BrO2 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 2-(2-bromophenyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(c2ccccc2Br)O1 |
| InChI | InChI=1S/C11H9BrO2/c12-9-5-2-1-4-8(9)10-6-3-7-11(13)14-10/h1-5,7,10H,6H2 |
| InChIKey | MMMZEZGABZIJCI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |