C10H10BrNO — CID 125477090
(5S)-5-(2-bromophenyl)-2-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 125477090) has the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. Its IUPAC name is (5S)-5-(2-bromophenyl)-2-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (5S)-5-(2-bromophenyl)-2-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 125477090 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | (5S)-5-(2-bromophenyl)-2-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=NC[C@H](c2ccccc2Br)O1 |
| InChI | InChI=1S/C10H10BrNO/c1-7-12-6-10(13-7)8-4-2-3-5-9(8)11/h2-5,10H,6H2,1H3/t10-/m1/s1 |
| InChIKey | NUVHZKAECLJYNI-SNVBAGLBSA-N |
| XLogP | 2.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |