C17H20O3 — CID 90809149
(7,7-dimethyl-4a,5,6,10a-tetrahydroxanthen-4-yl) acetate (PubChem CID 90809149) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (7,7-dimethyl-4a,5,6,10a-tetrahydroxanthen-4-yl) acetate.
| Compound Name | (7,7-dimethyl-4a,5,6,10a-tetrahydroxanthen-4-yl) acetate |
|---|---|
| PubChem CID | 90809149 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (7,7-dimethyl-4a,5,6,10a-tetrahydroxanthen-4-yl) acetate |
| SMILES | CC(=O)OC1=CC=CC2=CC3=CC(C)(C)CCC3OC21 |
| InChI | InChI=1S/C17H20O3/c1-11(18)19-15-6-4-5-12-9-13-10-17(2,3)8-7-14(13)20-16(12)15/h4-6,9-10,14,16H,7-8H2,1-3H3 |
| InChIKey | KICASVQNZLBTJL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |