C22H44O3S — CID 159229294
(2S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yloxy)-6-(6-propan-2-ylsulfanylhexyl)oxane (PubChem CID 159229294) has the molecular formula C22H44O3S and a molecular weight of 388.66 g/mol. Its IUPAC name is (2S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yloxy)-6-(6-propan-2-ylsulfanylhexyl)oxane.
| Compound Name | (2S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yloxy)-6-(6-propan-2-ylsulfanylhexyl)oxane |
|---|---|
| PubChem CID | 159229294 |
| Molecular Formula | C22H44O3S |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (2S,4R,5S)-3,4-dimethyl-2,5-di(propan-2-yloxy)-6-(6-propan-2-ylsulfanylhexyl)oxane |
| SMILES | CC(C)O[C@H]1OC(CCCCCCSC(C)C)[C@@H](OC(C)C)[C@H](C)C1C |
| InChI | InChI=1S/C22H44O3S/c1-15(2)23-21-18(7)19(8)22(24-16(3)4)25-20(21)13-11-9-10-12-14-26-17(5)6/h15-22H,9-14H2,1-8H3/t18-,19?,20?,21+,22+/m1/s1 |
| InChIKey | XCWDLNHZGUCKOW-XGQIVCTBSA-N |
| XLogP | 6.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|