C18H28N4O11 — CID 159247317
5,5-dinitrocyclooctan-1-one;9,9-dinitro-1,4-dioxaspiro[4.7]dodecane (PubChem CID 159247317) has the molecular formula C18H28N4O11 and a molecular weight of 476.44 g/mol. Its IUPAC name is 5,5-dinitrocyclooctan-1-one;9,9-dinitro-1,4-dioxaspiro[4.7]dodecane.
| Compound Name | 5,5-dinitrocyclooctan-1-one;9,9-dinitro-1,4-dioxaspiro[4.7]dodecane |
|---|---|
| PubChem CID | 159247317 |
| Molecular Formula | C18H28N4O11 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 5,5-dinitrocyclooctan-1-one;9,9-dinitro-1,4-dioxaspiro[4.7]dodecane |
| SMILES | O=C1CCCC([N+](=O)[O-])([N+](=O)[O-])CCC1.O=[N+]([O-])C1([N+](=O)[O-])CCCC2(CCC1)OCCO2 |
| InChI | InChI=1S/C10H16N2O6.C8H12N2O5/c13-11(14)9(12(15)16)3-1-5-10(6-2-4-9)17-7-8-18-10;11-7-3-1-5-8(9(12)13,10(14)15)6-2-4-7/h1-8H2;1-6H2 |
| InChIKey | KUVOFRTVFPYNKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 208.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|