C13H18N2O6S — CID 142131328
8-(4-nitrocyclohexa-1,3-dien-1-yl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 142131328) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is 8-(4-nitrocyclohexa-1,3-dien-1-yl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(4-nitrocyclohexa-1,3-dien-1-yl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 142131328 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 8-(4-nitrocyclohexa-1,3-dien-1-yl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | O=[N+]([O-])C1=CC=C(S(=O)(=O)N2CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C13H18N2O6S/c16-15(17)11-1-3-12(4-2-11)22(18,19)14-7-5-13(6-8-14)20-9-10-21-13/h1,3H,2,4-10H2 |
| InChIKey | OCSGIUXJOJKUAY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|