C13H22N2O4 — CID 159251046
(E,4S)-4-[[2-(butanoylamino)acetyl]-methylamino]-2-methylpent-2-enoic acid (PubChem CID 159251046) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is (E,4S)-4-[[2-(butanoylamino)acetyl]-methylamino]-2-methylpent-2-enoic acid.
| Compound Name | (E,4S)-4-[[2-(butanoylamino)acetyl]-methylamino]-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 159251046 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (E,4S)-4-[[2-(butanoylamino)acetyl]-methylamino]-2-methylpent-2-enoic acid |
| SMILES | CCCC(=O)NCC(=O)N(C)[C@@H](C)/C=C(\C)C(=O)O |
| InChI | InChI=1S/C13H22N2O4/c1-5-6-11(16)14-8-12(17)15(4)10(3)7-9(2)13(18)19/h7,10H,5-6,8H2,1-4H3,(H,14,16)(H,18,19)/b9-7+/t10-/m0/s1 |
| InChIKey | YIEQZANZEJWABL-PCYYEKQGSA-N |
| XLogP | 0.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|