C15H31N3 — CID 159260597
8-N-(4-iminopentyl)-1-N-methylnon-8-ene-1,8-diamine (PubChem CID 159260597) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 8-N-(4-iminopentyl)-1-N-methylnon-8-ene-1,8-diamine.
| Compound Name | 8-N-(4-iminopentyl)-1-N-methylnon-8-ene-1,8-diamine |
|---|---|
| PubChem CID | 159260597 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 8-N-(4-iminopentyl)-1-N-methylnon-8-ene-1,8-diamine |
| SMILES | [H]/N=C(\C)CCCNC(=C)CCCCCCCNC |
| InChI | InChI=1S/C15H31N3/c1-14(16)10-9-13-18-15(2)11-7-5-4-6-8-12-17-3/h16-18H,2,4-13H2,1,3H3/b16-14+ |
| InChIKey | KWLNWFPGJKZTDC-JQIJEIRASA-N |
| XLogP | 3.47 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|