About 2H-3-benzazepine;dihydrate;dihydrochloride
2H-3-benzazepine;dihydrate;dihydrochloride (PubChem CID 159261950) has the molecular formula C10H15Cl2NO2
and a molecular weight of 252.14 g/mol. Its IUPAC name is 2H-3-benzazepine;dihydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2H-3-benzazepine;dihydrate;dihydrochloride |
| PubChem CID | 159261950 |
| Molecular Formula | C10H15Cl2NO2 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2H-3-benzazepine;dihydrate;dihydrochloride |
| SMILES | C1=NCC=c2ccccc2=C1.Cl.Cl.O.O |
| InChI | InChI=1S/C10H9N.2ClH.2H2O/c1-2-4-10-6-8-11-7-5-9(10)3-1;;;;/h1-7H,8H2;2*1H;2*1H2 |
| InChIKey | KWPVPWLDNLMZGH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-3-benzazepine;dihydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-3-benzazepine;dihydrate;dihydrochloride?
The IUPAC name of 2H-3-benzazepine;dihydrate;dihydrochloride (CID 159261950) is 2H-3-benzazepine;dihydrate;dihydrochloride.
What is the SMILES notation for 2H-3-benzazepine;dihydrate;dihydrochloride?
The canonical SMILES for 2H-3-benzazepine;dihydrate;dihydrochloride is C1=NCC=c2ccccc2=C1.Cl.Cl.O.O.
What is the InChIKey of 2H-3-benzazepine;dihydrate;dihydrochloride?
The InChIKey is KWPVPWLDNLMZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.2ClH.2H2O/c1-2-4-10-6-8-11-7-5-9(10)3-1;;;;/h1-7H,8H2;2*1H;2*1H2.
What are the key properties of 2H-3-benzazepine;dihydrate;dihydrochloride?
2H-3-benzazepine;dihydrate;dihydrochloride has a molecular weight of 252.14 g/mol, XLogP of -0.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-3-benzazepine;dihydrate;dihydrochloride is sourced from PubChem (CID 159261950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).