About CID 86213528
CID 86213528 (PubChem CID 86213528) has the molecular formula C8H6Si
and a molecular weight of 130.22 g/mol.
Molecular Properties
| Compound Name | CID 86213528 |
| PubChem CID | 86213528 |
| Molecular Formula | C8H6Si |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | — |
| SMILES | C1=c2ccccc2=C[Si]1 |
| InChI | InChI=1S/C8H6Si/c1-2-4-8-6-9-5-7(8)3-1/h1-6H |
| InChIKey | OGJHVIUKMCCESK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 86213528 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86213528?
The IUPAC name of CID 86213528 (CID 86213528) is not available.
What is the SMILES notation for CID 86213528?
The canonical SMILES for CID 86213528 is C1=c2ccccc2=C[Si]1.
What is the InChIKey of CID 86213528?
The InChIKey is OGJHVIUKMCCESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Si/c1-2-4-8-6-9-5-7(8)3-1/h1-6H.
What are the key properties of CID 86213528?
CID 86213528 has a molecular weight of 130.22 g/mol, XLogP of -0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86213528 is sourced from PubChem (CID 86213528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).