acetic acid;dihydroxy(dioxo)chromium;nitric acid

C2H7CrNO9 — CID 159266357

IUPACacetic acid;dihydroxy(dioxo)chromium;nitric acid
SMILESCC(=O)O.O=[Cr](=O)(O)O.O=[N+]([O-])O
InChIInChI=1S/C2H4O2.Cr.HNO3.2H2O.2O/c1-2(3)4;;2-1(3)4;;;;/h1H3,(H,3,4);;(H,2,3,4);2*1H2;;/q;+2;;;;;/p-2
InChIKeyRFTWWXSLAIOXPW-UHFFFAOYSA-L
MW241.07 g/mol
LogP-1.61
Rot. Bonds

About acetic acid;dihydroxy(dioxo)chromium;nitric acid

acetic acid;dihydroxy(dioxo)chromium;nitric acid (PubChem CID 159266357) has the molecular formula C2H7CrNO9 and a molecular weight of 241.07 g/mol. Its IUPAC name is acetic acid;dihydroxy(dioxo)chromium;nitric acid.

Molecular Properties

Compound Nameacetic acid;dihydroxy(dioxo)chromium;nitric acid
PubChem CID159266357
Molecular FormulaC2H7CrNO9
Molecular Weight241.07 g/mol
Exact Mass240.95
IUPAC Nameacetic acid;dihydroxy(dioxo)chromium;nitric acid
SMILESCC(=O)O.O=[Cr](=O)(O)O.O=[N+]([O-])O
InChIInChI=1S/C2H4O2.Cr.HNO3.2H2O.2O/c1-2(3)4;;2-1(3)4;;;;/h1H3,(H,3,4);;(H,2,3,4);2*1H2;;/q;+2;;;;;/p-2
InChIKeyRFTWWXSLAIOXPW-UHFFFAOYSA-L
XLogP-1.61
TPSA175.27 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.07
LogP ≤ 5-1.61
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze acetic acid;dihydroxy(dioxo)chromium;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

acetic acid;cobalt(3+);trinitrate
CID 174400118
hydrogen peroxide;nitric acid
CID 22590704
nitric acid;bis(ruthenium(3+));hexaacetate
CID 172717903
carbonic acid;methane;nitric acid
CID 172861779
carbonic acid;cerium;nitric acid
CID 174736285
(E)-but-2-enedioic acid;bis(nitric acid)
CID 172779098
acetic acid;benzene;ethane;nitromethane
CID 91300577
methanol;nitric acid;yttrium
CID 20642582
dilithium;hydride;nitric acid;oxalic acid
CID 173422788
acetamide;guanidine;nitric acid
CID 173438373
einsteinium;tris(nitric acid)
CID 131879224
alumane;tris(nitric acid)
CID 173196891

Frequently Asked Questions

What is the IUPAC name of acetic acid;dihydroxy(dioxo)chromium;nitric acid?
The IUPAC name of acetic acid;dihydroxy(dioxo)chromium;nitric acid (CID 159266357) is acetic acid;dihydroxy(dioxo)chromium;nitric acid.
What is the SMILES notation for acetic acid;dihydroxy(dioxo)chromium;nitric acid?
The canonical SMILES for acetic acid;dihydroxy(dioxo)chromium;nitric acid is CC(=O)O.O=[Cr](=O)(O)O.O=[N+]([O-])O.
What is the InChIKey of acetic acid;dihydroxy(dioxo)chromium;nitric acid?
The InChIKey is RFTWWXSLAIOXPW-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H4O2.Cr.HNO3.2H2O.2O/c1-2(3)4;;2-1(3)4;;;;/h1H3,(H,3,4);;(H,2,3,4);2*1H2;;/q;+2;;;;;/p-2.
What are the key properties of acetic acid;dihydroxy(dioxo)chromium;nitric acid?
acetic acid;dihydroxy(dioxo)chromium;nitric acid has a molecular weight of 241.07 g/mol, XLogP of -1.61, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;dihydroxy(dioxo)chromium;nitric acid is sourced from PubChem (CID 159266357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).