C22H30ClNO3 — CID 159269090
(14S)-9-methoxy-4,7-dimethyl-4-(2-methylprop-2-enyl)-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol chloride (PubChem CID 159269090) has the molecular formula C22H30ClNO3 and a molecular weight of 391.94 g/mol. Its IUPAC name is (14S)-9-methoxy-4,7-dimethyl-4-(2-methylprop-2-enyl)-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol chloride.
| Compound Name | (14S)-9-methoxy-4,7-dimethyl-4-(2-methylprop-2-enyl)-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol chloride |
|---|---|
| PubChem CID | 159269090 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (14S)-9-methoxy-4,7-dimethyl-4-(2-methylprop-2-enyl)-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol chloride |
| SMILES | C=C(C)C[N+]1(C)CCC23C=C[C@@H](O)CC2Oc2c(OC)cc(C)c(c23)C1.[Cl-] |
| InChI | InChI=1S/C22H30NO3.ClH/c1-14(2)12-23(4)9-8-22-7-6-16(24)11-19(22)26-21-18(25-5)10-15(3)17(13-23)20(21)22;/h6-7,10,16,19,24H,1,8-9,11-13H2,2-5H3;1H/q+1;/p-1/t16-,19?,22?,23?;/m1./s1 |
| InChIKey | RHELKSYLIYXAQU-UOTYRPFRSA-M |
| XLogP | 0.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|