C19H23BrN2O4 — CID 25007383
(12S,14R)-4-(2-amino-2-oxoethyl)-7-bromo-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-olate (PubChem CID 25007383) has the molecular formula C19H23BrN2O4 and a molecular weight of 423.31 g/mol. Its IUPAC name is (12S,14R)-4-(2-amino-2-oxoethyl)-7-bromo-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-olate.
| Compound Name | (12S,14R)-4-(2-amino-2-oxoethyl)-7-bromo-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-olate |
|---|---|
| PubChem CID | 25007383 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (12S,14R)-4-(2-amino-2-oxoethyl)-7-bromo-9-methoxy-4-methyl-11-oxa-4-azoniatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17),15-tetraen-14-olate |
| SMILES | COc1cc(Br)c2c3c1O[C@H]1C[C@@H]([O-])C=CC31CC[N+](C)(CC(N)=O)C2 |
| InChI | InChI=1S/C19H23BrN2O4/c1-22(10-16(21)24)6-5-19-4-3-11(23)7-15(19)26-18-14(25-2)8-13(20)12(9-22)17(18)19/h3-4,8,11,15H,5-7,9-10H2,1-2H3,(H2,21,24)/t11-,15-,19?,22?/m0/s1 |
| InChIKey | IADIVJMZFKFLGU-AKJLDZQASA-N |
| XLogP | 0.98 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|