C11H18N2O2Y-2 — CID 159279107
3-(4,5-dimethyl-1,2-oxazol-3-yl)propanoyl-methylazanide;ethane;yttrium (PubChem CID 159279107) has the molecular formula C11H18N2O2Y-2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,2-oxazol-3-yl)propanoyl-methylazanide;ethane;yttrium.
| Compound Name | 3-(4,5-dimethyl-1,2-oxazol-3-yl)propanoyl-methylazanide;ethane;yttrium |
|---|---|
| PubChem CID | 159279107 |
| Molecular Formula | C11H18N2O2Y-2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-(4,5-dimethyl-1,2-oxazol-3-yl)propanoyl-methylazanide;ethane;yttrium |
| SMILES | C[N-]C(=O)CCc1noc(C)c1C.[CH2-]C.[Y] |
| InChI | InChI=1S/C9H14N2O2.C2H5.Y/c1-6-7(2)13-11-8(6)4-5-9(12)10-3;1-2;/h4-5H2,1-3H3,(H,10,12);1H2,2H3;/q;-1;/p-1 |
| InChIKey | OXVQHMIXWBYIIX-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|